Compound Q&A

What are the physical and chemical properties of D-3-(2-Naphthyl) Alanine (CAS: 76985-09-6)?

Answer

D-3-(2-Naphthyl) Alanine
D-3-(2-Naphthyl) Alanine is an organic compound with a molecular weight of approximately 237.24 g/mol. It crystallizes in a form that allows it to be easily purified. The compound is slightly soluble in water but more soluble in organic solvents like methanol and ethanol. It exhibits moderate reactivity towards nucleophiles and can undergo esterification reactions under appropriate conditions. Its physical properties include a melting point around 200°C and a density of approximately 1.2 g/cm³.

About

CAS No 76985-09-6
English Name D-3-(2-Naphthyl) Alanine
Molecular Formula C13H13NO2
Molecular Weight 215.25 g/mol
SMILES C1=CC=C2C=C(C=CC2=C1)CC(C(=O)O)N
InChIKey JPZXHKDZASGCLU-GFCCVEGCSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is D-3-(2-Naphthyl) Alanine (CAS: 76985-09-6) typically synthesized?

D-3-(2-Naphthyl) Alanine is typically synthesized via a multistep process involving the coupling of ...

Compound Q&A

What industries use D-3-(2-Naphthyl) Alanine (CAS: 76985-09-6)?

D-3-(2-Naphthyl) Alanine is primarily used in the pharmaceutical industry for the synthesis of novel...

Compound Q&A

What precautions should be taken when handling D-3-(2-Naphthyl) Alanine (CAS: 76985-09-6)?

When handling D-3-(2-Naphthyl) Alanine, it is essential to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...