Compound Q&A

How is [3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3) typically synthesized?

Answer

[3-(Trifluoromethyl)phenyl]boronic acid
[3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3) is usually synthesized via a boronation reaction of 3-(trifluoromethyl)phenol with a boronate ester or a boronic acid derivative. The reaction often employs a palladium catalyst and a base such as potassium carbonate. The yield can be up to 90%, and the reaction is selective and efficient.

About

CAS No 1423-26-3
English Name [3-(Trifluoromethyl)phenyl]boronic acid
Molecular Formula C7H6BF3O2
Molecular Weight 189.92899999999995 g/mol
EINECS 604-284-2
SMILES B(C1=CC(=CC=C1)C(F)(F)F)(O)O
InChIKey WOAORAPRPVIATR-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3)?

[3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3) is a white crystalline solid with a molecul...

Compound Q&A

What industries use [3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3)?

[3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3) is primarily used in the pharmaceutical and...

Compound Q&A

What precautions should be taken when handling [3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3)?

When handling [3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3), it is essential to use appro...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...