Compound Q&A

What are the physical and chemical properties of [3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3)?

Answer

[3-(Trifluoromethyl)phenyl]boronic acid
[3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3) is a white crystalline solid with a molecular weight of approximately 287.09 g/mol. It is sparingly soluble in water but easily soluble in organic solvents like methanol and ethanol. This compound exhibits good reactivity in boronate ester formation and is commonly used in organic synthesis, particularly in Suzuki coupling reactions.

About

CAS No 1423-26-3
English Name [3-(Trifluoromethyl)phenyl]boronic acid
Molecular Formula C7H6BF3O2
Molecular Weight 189.93 g/mol
EINECS 604-284-2
SMILES B(C1=CC(=CC=C1)C(F)(F)F)(O)O
InChIKey WOAORAPRPVIATR-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is [3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3) typically synthesized?

[3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3) is usually synthesized via a boronation rea...

Compound Q&A

What industries use [3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3)?

[3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3) is primarily used in the pharmaceutical and...

Compound Q&A

What precautions should be taken when handling [3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3)?

When handling [3-(Trifluoromethyl)phenyl]boronic acid (CAS: 1423-26-3), it is essential to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...