Compound Q&A

What industries use Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9)?

Answer

Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (1:1)
Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9) is used in various industries. It is particularly important in the pharmaceutical industry for the synthesis of certain medicinal compounds. Its applications also extend to polymer chemistry for specific polymer modifications, and it has potential uses in the sensor and semiconductor industries for specialized chemical and physical properties.

About

CAS No 56974-61-9
English Name Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (1:1)
Molecular Formula C17H27N3O7S
Molecular Weight 417.48 g/mol
SMILES CCOC(=O)C1=CC=C(C=C1)OC(=O)CCCCCN=C(N)N.CS(=O)(=O)O
InChIKey DNTNDFLIKUKKOC-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9)?

Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9) is a white cryst...

Compound Q&A

How is Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9) typically synthesized?

Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9) is typically syn...

Compound Q&A

What precautions should be taken when handling Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9)?

When handling Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...