Compound Q&A

How is Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9) typically synthesized?

Answer

Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (1:1)
Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9) is typically synthesized via a multi-step reaction involving the condensation of 4-hydroxybenzoic acid with 6-carbamimidohexanoic acid, followed by esterification and methanesulfonation. The synthesis involves the use of a catalyst and requires careful temperature control to ensure high yield and selectivity. The product is then purified by recrystallization or chromatography methods.

About

CAS No 56974-61-9
English Name Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (1:1)
Molecular Formula C17H27N3O7S
Molecular Weight 417.48 g/mol
SMILES CCOC(=O)C1=CC=C(C=C1)OC(=O)CCCCCN=C(N)N.CS(=O)(=O)O
InChIKey DNTNDFLIKUKKOC-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9)?

Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9) is a white cryst...

Compound Q&A

What industries use Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9)?

Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9) is used in vario...

Compound Q&A

What precautions should be taken when handling Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9)?

When handling Ethyl 4-[(6-carbamimidamidohexanoyl)oxy]benzoate methanesulfonate (CAS: 56974-61-9), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...