Compound Q&A

What industries use N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3)?

Answer

N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-)
N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3) is widely used in pharmaceuticals, where it serves as a catalyst in various organic transformations. It is also found in polymer synthesis, particularly in the production of certain functional polymers. Additionally, it is used in the development of sensors and semiconductors due to its unique properties.

About

English Name N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-)
Molecular Formula C32H12BF20N
Molecular Weight 801.2 g/mol
SMILES [B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.C[NH+](C)C1=CC=CC=C1
InChIKey BRHZQNMGSKUUMN-UHFFFAOYSA-O
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3)?

N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3) is a crystalline soli...

Compound Q&A

How is N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3) typically synthesized?

N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3) is typically synthesi...

Compound Q&A

What precautions should be taken when handling N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3)?

When handling N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...