Compound Q&A

What are the physical and chemical properties of N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3)?

Answer

N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-)
N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3) is a crystalline solid with a high molecular weight. Its solubility is low in common organic solvents but high in non-aqueous solvents. It has a high reactivity with Lewis acids and bases, making it useful in various chemical reactions. This compound is known for its stability and is often used in organic synthesis and as a Lewis acid catalyst.

About

English Name N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-)
Molecular Formula C32H12BF20N
Molecular Weight 801.2 g/mol
SMILES [B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.C[NH+](C)C1=CC=CC=C1
InChIKey BRHZQNMGSKUUMN-UHFFFAOYSA-O
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3) typically synthesized?

N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3) is typically synthesi...

Compound Q&A

What industries use N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3)?

N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3) is widely used in pha...

Compound Q&A

What precautions should be taken when handling N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3)?

When handling N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate(1-) (CAS: 118612-00-3), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...