Compound Q&A

How is Thaumatin (CAS: 53850-34-3) typically synthesized?

Answer

Thaumatin
Thaumatin (CAS: 53850-34-3) is typically synthesized through fermentation using genetically modified yeast or bacteria. The process involves genetic engineering to produce thaumatin-like proteins, which are then purified and crystallized. Commonly used yeast strains include Pichia pastoris. The fermentation process is optimized to achieve high yield and selectivity, with the final product being purified through steps like filtration, chromatography, and lyophilization.

About

CAS No 53850-34-3
English Name Thaumatin
Molecular Formula C19H29N3O3S
Molecular Weight 379.5 g/mol
SMILES CC(=O)NC1=CC=C(C=C1)S(=O)(=O)N2CCN(CC2)C3CCCCCC3
InChIKey IVPOQXWRUMMORK-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Thaumatin (CAS: 53850-34-3)?

Thaumatin (CAS: 53850-34-3) is a sweet protein with a crystalline form. It has a molecular weight of...

Compound Q&A

What industries use Thaumatin (CAS: 53850-34-3)?

Thaumatin (CAS: 53850-34-3) is primarily used in the food and beverage industry as a natural sweeten...

Compound Q&A

What precautions should be taken when handling Thaumatin (CAS: 53850-34-3)?

When handling Thaumatin (CAS: 53850-34-3), it is important to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...