Compound Q&A

What precautions should be taken when handling Adenosine,5'-[(3-amino-3-carboxypropyl)methylsulfonio]-5'-deoxy-, inner salt (CAS: 17176-17-9)?

Answer

Adenosine,5'-[(3-amino-3-carboxypropyl)methylsulfonio]-5'-deoxy-, inner salt (9CI)
When handling this compound, appropriate personal protective equipment (PPE), such as gloves and goggles, should be worn. It should be stored in a well-ventilated area and handled under a fume hood to minimize exposure to vapors. Spills should be cleaned up using appropriate cleaning agents, and the Material Safety Data Sheet (MSDS) should be consulted for detailed instructions.

About

CAS No 17176-17-9
English Name Adenosine,5'-[(3-amino-3-carboxypropyl)methylsulfonio]-5'-deoxy-, inner salt (9CI)
Molecular Formula C15H22N6O5S
Molecular Weight 398.4 g/mol
SMILES C[S+](CCC(C(=O)[O-])N)CC1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)O
InChIKey MEFKEPWMEQBLKI-YDBXVIPQSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Adenosine,5'-[(3-amino-3-carboxypropyl)methylsulfonio]-5'-deoxy-, inner salt (CAS: 17176-17-9)?

The compound is a crystalline solid with a molecular weight of approximately 552.44 g/mol. It has mo...

Compound Q&A

How is Adenosine,5'-[(3-amino-3-carboxypropyl)methylsulfonio]-5'-deoxy-, inner salt (CAS: 17176-17-9) typically synthesized?

The compound is typically synthesized through the condensation of adenosine with methylsulfonate fol...

Compound Q&A

What industries use Adenosine,5'-[(3-amino-3-carboxypropyl)methylsulfonio]-5'-deoxy-, inner salt (CAS: 17176-17-9)?

This compound is used in the pharmaceutical industry for its potential as a drug candidate, particul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...