Compound Q&A

What are the physical and chemical properties of Adenosine,5'-[(3-amino-3-carboxypropyl)methylsulfonio]-5'-deoxy-, inner salt (CAS: 17176-17-9)?

Answer

Adenosine,5'-[(3-amino-3-carboxypropyl)methylsulfonio]-5'-deoxy-, inner salt (9CI)
The compound is a crystalline solid with a molecular weight of approximately 552.44 g/mol. It has moderate solubility in water and poor solubility in organic solvents. The compound is highly reactive towards nucleophilic substitution reactions and can form stable complexes with metal ions.

About

CAS No 17176-17-9
English Name Adenosine,5'-[(3-amino-3-carboxypropyl)methylsulfonio]-5'-deoxy-, inner salt (9CI)
Molecular Formula C15H22N6O5S
Molecular Weight 398.4 g/mol
SMILES C[S+](CCC(C(=O)[O-])N)CC1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)O
InChIKey MEFKEPWMEQBLKI-YDBXVIPQSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is Adenosine,5'-[(3-amino-3-carboxypropyl)methylsulfonio]-5'-deoxy-, inner salt (CAS: 17176-17-9) typically synthesized?

The compound is typically synthesized through the condensation of adenosine with methylsulfonate fol...

Compound Q&A

What industries use Adenosine,5'-[(3-amino-3-carboxypropyl)methylsulfonio]-5'-deoxy-, inner salt (CAS: 17176-17-9)?

This compound is used in the pharmaceutical industry for its potential as a drug candidate, particul...

Compound Q&A

What precautions should be taken when handling Adenosine,5'-[(3-amino-3-carboxypropyl)methylsulfonio]-5'-deoxy-, inner salt (CAS: 17176-17-9)?

When handling this compound, appropriate personal protective equipment (PPE), such as gloves and gog...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...