Compound Q&A

How is mesitylboronic acid (CAS: 5980-97-2) typically synthesized?

Answer

Mesitylboronic acid
Mesitylboronic acid is usually synthesized through the reaction of mesityl oxide with boron tribromide in the presence of a base. The process involves the generation of a mesityl borate salt, which then forms mesitylboronic acid upon treatment with water or a protic solvent. The reaction is typically carried out in a glass or Teflon vessel to avoid corrosion.

About

CAS No 5980-97-2
English Name Mesitylboronic acid
Molecular Formula C9H13BO2
Molecular Weight 164.01 g/mol
SMILES B(C1=C(C=C(C=C1C)C)C)(O)O
InChIKey BZXQRXJJJUZZAJ-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Mesitylboronic acid (CAS: 5980-97-2)?

Mesitylboronic acid (CAS: 5980-97-2) is a white crystalline solid. Its molecular weight is approxima...

Compound Q&A

What industries use mesitylboronic acid (CAS: 5980-97-2)?

Mesitylboronic acid finds applications in the pharmaceutical industry for the synthesis of chiral co...

Compound Q&A

What precautions should be taken when handling mesitylboronic acid (CAS: 5980-97-2)?

When handling mesitylboronic acid, proper personal protective equipment (PPE) including gloves, gogg...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...