Compound Q&A

What are the physical and chemical properties of Mesitylboronic acid (CAS: 5980-97-2)?

Answer

Mesitylboronic acid
Mesitylboronic acid (CAS: 5980-97-2) is a white crystalline solid. Its molecular weight is approximately 165.13 g/mol. It has a very low water solubility but is soluble in organic solvents such as dichloromethane and acetonitrile. Chemically, it exhibits typical reactivity of boronic acids, undergoing nucleophilic substitution reactions under mild conditions.

About

CAS No 5980-97-2
English Name Mesitylboronic acid
Molecular Formula C9H13BO2
Molecular Weight 164.01 g/mol
SMILES B(C1=C(C=C(C=C1C)C)C)(O)O
InChIKey BZXQRXJJJUZZAJ-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is mesitylboronic acid (CAS: 5980-97-2) typically synthesized?

Mesitylboronic acid is usually synthesized through the reaction of mesityl oxide with boron tribromi...

Compound Q&A

What industries use mesitylboronic acid (CAS: 5980-97-2)?

Mesitylboronic acid finds applications in the pharmaceutical industry for the synthesis of chiral co...

Compound Q&A

What precautions should be taken when handling mesitylboronic acid (CAS: 5980-97-2)?

When handling mesitylboronic acid, proper personal protective equipment (PPE) including gloves, gogg...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...