Compound Q&A

How is sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate (CAS: 1639-66-3) typically synthesized?

Answer

sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate
Sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate is typically synthesized through the sulfonation of 1,4-bis(octyloxy)-1,4-dioxobutane followed by sodium hydroxide treatment. Commonly used catalysts include sulfuric acid, and the reaction involves the introduction of a sulfonic acid group (-SO3Na) to the compound. The yield and selectivity of the synthesis are high, making it a reliable method for preparing this compound.

About

CAS No 1639-66-3
English Name sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate
Molecular Formula C20H38NaO7S
Molecular Weight 445.5663 g/mol
SMILES [Na+].CCCCCCCCOC(=O)CC(C(=O)OCCCCCCCC)S(=O)(=O)[O-]
InChIKey RCIJACVHOIKRAP-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate (CAS: 1639-66-3)?

Sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate (CAS: 1639-66-3) is a crystalline solid with a ...

Compound Q&A

What industries use sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate (CAS: 1639-66-3)?

Sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate (CAS: 1639-66-3) is utilized in various industr...

Compound Q&A

What precautions should be taken when handling sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate (CAS: 1639-66-3)?

When handling sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate (CAS: 1639-66-3), it is essential...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...