Compound Q&A

What are the physical and chemical properties of sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate (CAS: 1639-66-3)?

Answer

sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate
Sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate (CAS: 1639-66-3) is a crystalline solid with a molecular weight of approximately 642.75 g/mol. It is slightly soluble in water but highly soluble in organic solvents. The compound exhibits good water solubility due to its hydrophilic nature. Chemically, it is relatively stable but can react with strong acids to form its corresponding sulfonic acid. It is less reactive towards common bases and organic reagents.

About

CAS No 1639-66-3
English Name sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate
Molecular Formula C20H38NaO7S
Molecular Weight 445.57 g/mol
SMILES [Na+].CCCCCCCCOC(=O)CC(C(=O)OCCCCCCCC)S(=O)(=O)[O-]
InChIKey RCIJACVHOIKRAP-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate (CAS: 1639-66-3) typically synthesized?

Sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate is typically synthesized through the sulfonatio...

Compound Q&A

What industries use sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate (CAS: 1639-66-3)?

Sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate (CAS: 1639-66-3) is utilized in various industr...

Compound Q&A

What precautions should be taken when handling sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate (CAS: 1639-66-3)?

When handling sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate (CAS: 1639-66-3), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...