Compound Q&A

What precautions should be taken when handling 1,4-dihydrazinylphthalazine sulfate (CAS: 7327-87-9)?

Answer

1,4-dihydrazinylphthalazine sulfate
When handling 1,4-dihydrazinylphthalazine sulfate (CAS: 7327-87-9), it is important to wear appropriate personal protective equipment (PPE) such as gloves, safety glasses, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood. Spills should be cleaned up using appropriate absorbent materials, and the area should be flushed with water. Always consult the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

CAS No 7327-87-9
English Name 1,4-dihydrazinylphthalazine sulfate
Molecular Formula C8H12N6O4S
Molecular Weight 288.29 g/mol
SMILES C1=CC=C2C(=C1)C(=NN=C2NN)NN.OS(=O)(=O)O
InChIKey BWHAMWGGORIDBK-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,4-dihydrazinylphthalazine sulfate (CAS: 7327-87-9)?

1,4-Dihydrazinylphthalazine sulfate is a crystalline compound with a molecular weight of approximate...

Compound Q&A

How is 1,4-dihydrazinylphthalazine sulfate (CAS: 7327-87-9) typically synthesized?

1,4-Dihydrazinylphthalazine sulfate is typically synthesized by the sulfation of 1,4-dihydrazinylpht...

Compound Q&A

What industries use 1,4-dihydrazinylphthalazine sulfate (CAS: 7327-87-9)?

1,4-Dihydrazinylphthalazine sulfate is primarily used in the pharmaceutical industry for the synthes...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...