Compound Q&A

What industries use 1,4-dihydrazinylphthalazine sulfate (CAS: 7327-87-9)?

Answer

1,4-dihydrazinylphthalazine sulfate
1,4-Dihydrazinylphthalazine sulfate is primarily used in the pharmaceutical industry for the synthesis of certain active pharmaceutical ingredients. It also finds applications in the production of sensors and as a reagent in analytical chemistry. Its use in semiconductors and polymers is less common but may be utilized in specialized applications.

About

CAS No 7327-87-9
English Name 1,4-dihydrazinylphthalazine sulfate
Molecular Formula C8H12N6O4S
Molecular Weight 288.29 g/mol
SMILES C1=CC=C2C(=C1)C(=NN=C2NN)NN.OS(=O)(=O)O
InChIKey BWHAMWGGORIDBK-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,4-dihydrazinylphthalazine sulfate (CAS: 7327-87-9)?

1,4-Dihydrazinylphthalazine sulfate is a crystalline compound with a molecular weight of approximate...

Compound Q&A

How is 1,4-dihydrazinylphthalazine sulfate (CAS: 7327-87-9) typically synthesized?

1,4-Dihydrazinylphthalazine sulfate is typically synthesized by the sulfation of 1,4-dihydrazinylpht...

Compound Q&A

What precautions should be taken when handling 1,4-dihydrazinylphthalazine sulfate (CAS: 7327-87-9)?

When handling 1,4-dihydrazinylphthalazine sulfate (CAS: 7327-87-9), it is important to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...