Compound Q&A

What industries use Cefditoren Pivoxil (CAS: 117467-28-4)?

Answer

Cefditoren Pivoxil
Cefditoren pivoxil is primarily used in the pharmaceutical industry for the treatment of infections. It is also relevant in the medical industry for developing new antibiotics and antimicrobial agents. Its application in this sector is significant due to its efficacy and broad-spectrum activity.

About

English Name Cefditoren Pivoxil
Molecular Formula C25H28N6O7S3
Molecular Weight 620.74 g/mol
SMILES CC1=C(SC=N1)C=CC2=C(N3C(C(C3=O)NC(=O)C(=NOC)C4=CSC(=N4)N)SC2)C(=O)OCOC(=O)C(C)(C)C
InChIKey AFZFFLVORLEPPO-UVYJNCLZSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cefditoren Pivoxil (CAS: 117467-28-4)?

Cefditoren pivoxil is a crystalline compound with a molecular weight of approximately 535.73 g/mol. ...

Compound Q&A

How is Cefditoren Pivoxil (CAS: 117467-28-4) typically synthesized?

Cefditoren pivoxil is synthesized through a multi-step process involving the formation of a β-lactam...

Compound Q&A

What precautions should be taken when handling Cefditoren Pivoxil (CAS: 117467-28-4)?

When handling cefditoren pivoxil, appropriate personal protective equipment (PPE) such as gloves and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...