Compound Q&A

How is Cefditoren Pivoxil (CAS: 117467-28-4) typically synthesized?

Answer

Cefditoren Pivoxil
Cefditoren pivoxil is synthesized through a multi-step process involving the formation of a β-lactam ring. Key reactions include the Wittig reaction, condensation steps, and a Pivoyl chloride esterification. The synthesis typically yields around 80% purity, with the use of various catalysts and solvents ensuring high selectivity and efficiency.

About

English Name Cefditoren Pivoxil
Molecular Formula C25H28N6O7S3
Molecular Weight 620.74 g/mol
SMILES CC1=C(SC=N1)C=CC2=C(N3C(C(C3=O)NC(=O)C(=NOC)C4=CSC(=N4)N)SC2)C(=O)OCOC(=O)C(C)(C)C
InChIKey AFZFFLVORLEPPO-UVYJNCLZSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cefditoren Pivoxil (CAS: 117467-28-4)?

Cefditoren pivoxil is a crystalline compound with a molecular weight of approximately 535.73 g/mol. ...

Compound Q&A

What industries use Cefditoren Pivoxil (CAS: 117467-28-4)?

Cefditoren pivoxil is primarily used in the pharmaceutical industry for the treatment of infections....

Compound Q&A

What precautions should be taken when handling Cefditoren Pivoxil (CAS: 117467-28-4)?

When handling cefditoren pivoxil, appropriate personal protective equipment (PPE) such as gloves and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...