Compound Q&A

What industries use 6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol (CAS: 478-61-5)?

Answer

6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol
6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol is primarily used in the pharmaceutical industry for the synthesis of various bioactive compounds. It also finds application in the polymer industry as a precursor for the production of advanced materials. Additionally, it can be used in the formulation of certain chemical sensors and in the development of semiconductor materials.

About

CAS No 478-61-5
English Name 6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol
Molecular Formula C37H40N2O6
Molecular Weight 608.74 g/mol
SMILES CN1CCc2cc(c3cc2[C@@H]1Cc4ccc(cc4)Oc5cc(ccc5O)C[C@@H]6c7c(cc(c(c7O3)OC)OC)CCN6C)OC
InChIKey DFOCUWZXJBAUSQ-URLMMPGGSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol (CAS: 478-61-5)?

6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol is a crystalline solid with a molecular weight of appr...

Compound Q&A

How is 6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol (CAS: 478-61-5) typically synthesized?

6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol is synthesized through a multi-step process involving ...

Compound Q&A

What precautions should be taken when handling 6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol (CAS: 478-61-5)?

When handling 6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol, it is essential to use personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...