Compound Q&A

What are the physical and chemical properties of 6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol (CAS: 478-61-5)?

Answer

6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol
6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol is a crystalline solid with a molecular weight of approximately 354.36 g/mol. It has limited solubility in water but is soluble in organic solvents such as ethanol and acetone. Chemically, it is relatively stable but can react with strong bases and acids. It has a melting point of around 160-162°C and boiling point of approximately 325-327°C under reduced pressure.

About

CAS No 478-61-5
English Name 6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol
Molecular Formula C37H40N2O6
Molecular Weight 608.74 g/mol
SMILES CN1CCc2cc(c3cc2[C@@H]1Cc4ccc(cc4)Oc5cc(ccc5O)C[C@@H]6c7c(cc(c(c7O3)OC)OC)CCN6C)OC
InChIKey DFOCUWZXJBAUSQ-URLMMPGGSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is 6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol (CAS: 478-61-5) typically synthesized?

6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol is synthesized through a multi-step process involving ...

Compound Q&A

What industries use 6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol (CAS: 478-61-5)?

6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol is primarily used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol (CAS: 478-61-5)?

When handling 6,6',7-Trimethoxy-2,2'-dimethylberbaman-12-ol, it is essential to use personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...