Compound Q&A

What industries use Geraniin (CAS: 60976-49-0)?

Answer

Geraniin
Geraniin is used in various industries. In pharmaceuticals, it is an active ingredient in certain formulations. It is also used in polymers for its antioxidant properties. Additionally, it is applied in sensors for its reactivity and in semiconductors for specific functionalities. Its bioactivity makes it a valuable compound in natural product research and development.

About

CAS No 60976-49-0
English Name Geraniin
Molecular Formula C41H28O27
Molecular Weight 952.65 g/mol
SMILES c1c(cc(c(c1O)O)O)C(=O)O[C@H]2[C@H]3[C@@H]4[C@@H]([C@H](O2)COC(=O)c5cc(c(c(c5-c6c(cc(c(c6O)O)O)C(=O)O4)O)O)O)OC(=O)C7=CC(=O)[C@]8(C([C@@H]7c9c(cc(c(c9O8)O)O)C(=O)O3)(O)O)O
InChIKey JQQBXPCJFAKSPG-SVYIMCMUSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Geraniin (CAS: 60976-49-0)?

Geraniin is a polyphenol compound. It has a crystalline form and a molecular weight of approximately...

Compound Q&A

How is Geraniin (CAS: 60976-49-0) typically synthesized?

Geraniin is synthesized through a series of steps including esterification of geraniol with gallic a...

Compound Q&A

What precautions should be taken when handling Geraniin (CAS: 60976-49-0)?

When handling Geraniin, it is crucial to use personal protective equipment (PPE) such as gloves, gog...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...