Compound Q&A

How is Geraniin (CAS: 60976-49-0) typically synthesized?

Answer

Geraniin
Geraniin is synthesized through a series of steps including esterification of geraniol with gallic acid. Common methods involve using strong acids like sulfuric acid as catalysts. The yield is typically around 70-80%, with high selectivity towards the desired product. The process requires mild conditions to avoid degradation of the compound.

About

CAS No 60976-49-0
English Name Geraniin
Molecular Formula C41H28O27
Molecular Weight 952.65 g/mol
SMILES c1c(cc(c(c1O)O)O)C(=O)O[C@H]2[C@H]3[C@@H]4[C@@H]([C@H](O2)COC(=O)c5cc(c(c(c5-c6c(cc(c(c6O)O)O)C(=O)O4)O)O)O)OC(=O)C7=CC(=O)[C@]8(C([C@@H]7c9c(cc(c(c9O8)O)O)C(=O)O3)(O)O)O
InChIKey JQQBXPCJFAKSPG-SVYIMCMUSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Geraniin (CAS: 60976-49-0)?

Geraniin is a polyphenol compound. It has a crystalline form and a molecular weight of approximately...

Compound Q&A

What industries use Geraniin (CAS: 60976-49-0)?

Geraniin is used in various industries. In pharmaceuticals, it is an active ingredient in certain fo...

Compound Q&A

What precautions should be taken when handling Geraniin (CAS: 60976-49-0)?

When handling Geraniin, it is crucial to use personal protective equipment (PPE) such as gloves, gog...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...