Compound Q&A

What industries use 1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9)?

Answer

1-(Cedr-8-en-9-yl)ethanone
1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9) is mainly used in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also utilized in the formulation of certain cosmetic products and as a reagent in analytical chemistry for its reactivity towards nucleophiles. Additionally, it is explored for its potential applications in environmental sensing and as a precursor for organic semiconductors.

About

CAS No 32388-55-9
English Name 1-(Cedr-8-en-9-yl)ethanone
Molecular Formula C17H26O
Molecular Weight 246.39 g/mol
SMILES CC(C1=C(C)[C@@]2([H])C(C)(C)[C@]3([H])CC[C@@H](C)[C@@]3(C2)C1)=O
InChIKey YBUIAJZFOGJGLJ-SWRJLBSHSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9)?

1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9) is a colorless to light yellow liquid with a molecular ...

Compound Q&A

How is 1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9) typically synthesized?

1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9) can be synthesized through a Wittig reaction, where an ...

Compound Q&A

What precautions should be taken when handling 1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9)?

When handling 1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...