Compound Q&A

What are the physical and chemical properties of 1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9)?

Answer

1-(Cedr-8-en-9-yl)ethanone
1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9) is a colorless to light yellow liquid with a molecular weight of approximately 185.26 g/mol. It is slightly soluble in water but miscible with most organic solvents. This compound is reactive towards nucleophiles and can undergo rearrangement reactions under certain conditions. It is also prone to hydrolysis in the presence of water and acid.

About

CAS No 32388-55-9
English Name 1-(Cedr-8-en-9-yl)ethanone
Molecular Formula C17H26O
Molecular Weight 246.39 g/mol
SMILES CC(C1=C(C)[C@@]2([H])C(C)(C)[C@]3([H])CC[C@@H](C)[C@@]3(C2)C1)=O
InChIKey YBUIAJZFOGJGLJ-SWRJLBSHSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9) typically synthesized?

1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9) can be synthesized through a Wittig reaction, where an ...

Compound Q&A

What industries use 1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9)?

1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9) is mainly used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling 1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9)?

When handling 1-(Cedr-8-en-9-yl)ethanone (CAS: 32388-55-9), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...