Compound Q&A

What industries use 2-Bromo-1-fluoro-4-nitrobenzene (CAS: 701-45-1)?

Answer

2-Bromo-1-fluoro-4-nitrobenzene
2-Bromo-1-fluoro-4-nitrobenzene is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It also finds applications in organic synthesis as a versatile starting material for the preparation of other functionalized derivatives. In the polymer industry, it serves as a monomer precursor for the development of novel materials. Additionally, it has potential applications in sensor technology and as a building block in semiconductor manufacturing.

About

CAS No 701-45-1
English Name 2-Bromo-1-fluoro-4-nitrobenzene
Molecular Formula C6H3BrFNO2
Molecular Weight 220 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])Br)F
InChIKey FAWMTDSAMOCUAR-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-1-fluoro-4-nitrobenzene (CAS: 701-45-1)?

2-Bromo-1-fluoro-4-nitrobenzene is a crystalline solid with a molecular weight of 241.01 g/mol. It h...

Compound Q&A

How is 2-Bromo-1-fluoro-4-nitrobenzene (CAS: 701-45-1) typically synthesized?

2-Bromo-1-fluoro-4-nitrobenzene can be synthesized via bromination of 1-fluoro-4-nitrobenzene follow...

Compound Q&A

What precautions should be taken when handling 2-Bromo-1-fluoro-4-nitrobenzene (CAS: 701-45-1)?

When handling 2-Bromo-1-fluoro-4-nitrobenzene, proper personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...