Compound Q&A

How is 2-Chloro-3-nitrobenzoic acid (CAS: 3970-35-2) typically synthesized?

Answer

2-Chloro-3-nitrobenzoic acid
2-Chloro-3-nitrobenzoic acid is typically synthesized by the nitration of 2-chlorobenzoic acid followed by nitration. This involves the use of nitric acid and sulfuric acid as reagents, with careful control over temperature and reaction conditions to ensure high selectivity and yield.

About

CAS No 3970-35-2
English Name 2-Chloro-3-nitrobenzoic acid
Molecular Formula C7H4ClNO4
Molecular Weight 201.56 g/mol
SMILES C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)C(=O)O
InChIKey JRQDVRIQJJPHEQ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-3-nitrobenzoic acid (CAS: 3970-35-2)?

2-Chloro-3-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 213.03 ...

Compound Q&A

What industries use 2-Chloro-3-nitrobenzoic acid (CAS: 3970-35-2)?

2-Chloro-3-nitrobenzoic acid finds applications in the pharmaceutical industry as an intermediate in...

Compound Q&A

What precautions should be taken when handling 2-Chloro-3-nitrobenzoic acid (CAS: 3970-35-2)?

When handling 2-Chloro-3-nitrobenzoic acid, it is essential to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...