Compound Q&A

What are the physical and chemical properties of O-[2-(Diethylamino)-6-methyl-4-pyrimidinyl] O,O-dimethyl phosphorothioate (CAS: 29232-93-7)?

Answer

O-[2-(Diethylamino)-6-methyl-4-pyrimidinyl] O,O-dimethyl phosphorothioate
The compound has a crystalline form with a molecular weight of approximately 428.59 g/mol. It is poorly soluble in water but soluble in common organic solvents like ethanol and acetone. Chemically, it is reactive towards nucleophiles and can undergo substitution reactions. It has a melting point of around 165°C and is stable at room temperature but requires protection from moisture and air to prevent degradation.

About

CAS No 29232-93-7
English Name O-[2-(Diethylamino)-6-methyl-4-pyrimidinyl] O,O-dimethyl phosphorothioate
Molecular Formula C11H20N3O3PS
Molecular Weight 305.34 g/mol
SMILES CCN(CC)C1=NC(OP(=S)(OC)OC)=CC(C)=N1
InChIKey QHOQHJPRIBSPCY-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is O-[2-(Diethylamino)-6-methyl-4-pyrimidinyl] O,O-dimethyl phosphorothioate (CAS: 29232-93-7) typically synthesized?

The compound is typically synthesized via the phosphorothioylation of a dimethyl pyrimidine derivati...

Compound Q&A

What industries use O-[2-(Diethylamino)-6-methyl-4-pyrimidinyl] O,O-dimethyl phosphorothioate (CAS: 29232-93-7)?

This compound is primarily used in the pharmaceutical industry as an intermediate in the synthesis o...

Compound Q&A

What precautions should be taken when handling O-[2-(Diethylamino)-6-methyl-4-pyrimidinyl] O,O-dimethyl phosphorothioate (CAS: 29232-93-7)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...