Compound Q&A

How is [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4) typically synthesized?

Answer

[3-(Methoxycarbonyl)phenyl]boronic acid
The compound [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4) can be synthesized via several methods. One common approach involves the reaction of 3-(methoxycarbonyl)phenylboronic acid pinacol ester with methanol in the presence of a base such as sodium hydride. The yield is generally around 70-75%, and the reaction is performed under an inert atmosphere to prevent oxidation.

About

CAS No 99769-19-4
English Name [3-(Methoxycarbonyl)phenyl]boronic acid
Molecular Formula C8H9BO4
Molecular Weight 179.97 g/mol
SMILES B(C1=CC(=CC=C1)C(=O)OC)(O)O
InChIKey ALTLCJHSJMGSLT-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4)?

The compound [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4) is a white crystalline solid ...

Compound Q&A

What industries use [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4)?

The compound [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4) is widely used in the pharmac...

Compound Q&A

What precautions should be taken when handling [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4)?

When handling [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4), it is important to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...