Compound Q&A

What are the physical and chemical properties of [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4)?

Answer

[3-(Methoxycarbonyl)phenyl]boronic acid
The compound [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4) is a white crystalline solid with a molecular weight of approximately 224.24 g/mol. It has a low solubility in water (2.5 mg/mL) but is more soluble in organic solvents such as acetonitrile and methanol. The compound exhibits good reactivity in various chemical reactions, particularly in Suzuki coupling reactions due to the presence of the boronic acid moiety.

About

CAS No 99769-19-4
English Name [3-(Methoxycarbonyl)phenyl]boronic acid
Molecular Formula C8H9BO4
Molecular Weight 179.97 g/mol
SMILES B(C1=CC(=CC=C1)C(=O)OC)(O)O
InChIKey ALTLCJHSJMGSLT-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4) typically synthesized?

The compound [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4) can be synthesized via severa...

Compound Q&A

What industries use [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4)?

The compound [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4) is widely used in the pharmac...

Compound Q&A

What precautions should be taken when handling [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4)?

When handling [3-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99769-19-4), it is important to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...