Compound Q&A

What industries use Sodium 4-hydroxybenzoate (CAS: 114-63-6)?

Answer

Sodium 4-hydroxybenzoate
Sodium 4-hydroxybenzoate (CAS: 114-63-6) is primarily used in the pharmaceutical and food industries. It serves as a preservative and antioxidant in food products. In pharmaceuticals, it is used as a raw material in the synthesis of drugs, particularly those requiring a specific pKa or stability under certain conditions.

About

CAS No 114-63-6
English Name Sodium 4-hydroxybenzoate
Molecular Formula C7H5NaO3
Molecular Weight 160.1 g/mol
SMILES c1cc(ccc1C(=O)[O-])O.[Na+]
InChIKey ZLVSYODPTJZFMK-UHFFFAOYSA-M
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 4-hydroxybenzoate (CAS: 114-63-6)?

Sodium 4-hydroxybenzoate (CAS: 114-63-6) is a white crystalline solid with a molecular weight of app...

Compound Q&A

How is Sodium 4-hydroxybenzoate (CAS: 114-63-6) typically synthesized?

Sodium 4-hydroxybenzoate (CAS: 114-63-6) is typically synthesized by the reaction of benzoic acid wi...

Compound Q&A

What precautions should be taken when handling Sodium 4-hydroxybenzoate (CAS: 114-63-6)?

When handling Sodium 4-hydroxybenzoate (CAS: 114-63-6), appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...