Compound Q&A

What are the physical and chemical properties of Sodium 4-hydroxybenzoate (CAS: 114-63-6)?

Answer

Sodium 4-hydroxybenzoate
Sodium 4-hydroxybenzoate (CAS: 114-63-6) is a white crystalline solid with a molecular weight of approximately 198.15 g/mol. It is slightly soluble in water and more soluble in alcohol. Chemically, it is less reactive compared to its parent compound, benzoic acid, due to the presence of a hydroxyl group. It is stable under normal conditions but may degrade in strongly acidic or basic environments.

About

CAS No 114-63-6
English Name Sodium 4-hydroxybenzoate
Molecular Formula C7H5NaO3
Molecular Weight 160.1026 g/mol
SMILES c1cc(ccc1C(=O)[O-])O.[Na+]
InChIKey ZLVSYODPTJZFMK-UHFFFAOYSA-M
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Sodium 4-hydroxybenzoate (CAS: 114-63-6) typically synthesized?

Sodium 4-hydroxybenzoate (CAS: 114-63-6) is typically synthesized by the reaction of benzoic acid wi...

Compound Q&A

What industries use Sodium 4-hydroxybenzoate (CAS: 114-63-6)?

Sodium 4-hydroxybenzoate (CAS: 114-63-6) is primarily used in the pharmaceutical and food industries...

Compound Q&A

What precautions should be taken when handling Sodium 4-hydroxybenzoate (CAS: 114-63-6)?

When handling Sodium 4-hydroxybenzoate (CAS: 114-63-6), appropriate personal protective equipment (P...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...