Compound Q&A

What industries use (2S)-4-(Benzyloxy)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 86060-84-6)?

Answer

(2S)-4-(Benzyloxy)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-oxobutanoic acid
This compound is used in the pharmaceutical industry as a key intermediate in the synthesis of various medicinal compounds. It is also relevant to the polymer industry due to its reactivity and stability. Additionally, it has potential uses in sensor and semiconductor technology.

About

CAS No 86060-84-6
English Name (2S)-4-(Benzyloxy)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-oxobutanoic acid
Molecular Formula C26H23NO6
Molecular Weight 445.47 g/mol
SMILES OC(=O)[C@H](CC(=O)OCc1ccccc1)NC(=O)OCC2c3ccccc3-c4ccccc24
InChIKey OQGAELAJEGGNKG-QHCPKHFHSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-4-(Benzyloxy)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 86060-84-6)?

This compound is a white crystalline solid with a molecular weight of approximately 538.5 g/mol. It ...

Compound Q&A

How is (2S)-4-(Benzyloxy)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 86060-84-6) typically synthesized?

The compound is synthesized via a multi-step process involving protection of the amino group, esteri...

Compound Q&A

What precautions should be taken when handling (2S)-4-(Benzyloxy)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 86060-84-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and lab coat should be worn. Wor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...