Compound Q&A

What are the physical and chemical properties of (2S)-4-(Benzyloxy)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 86060-84-6)?

Answer

(2S)-4-(Benzyloxy)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-oxobutanoic acid
This compound is a white crystalline solid with a molecular weight of approximately 538.5 g/mol. It has a low solubility in water but is more soluble in organic solvents like DMSO. Chemically, it is stable but can react with bases to form salts. Its reactivity is moderate, and it can be derivatized under mild conditions.

About

CAS No 86060-84-6
English Name (2S)-4-(Benzyloxy)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-oxobutanoic acid
Molecular Formula C26H23NO6
Molecular Weight 445.47 g/mol
SMILES OC(=O)[C@H](CC(=O)OCc1ccccc1)NC(=O)OCC2c3ccccc3-c4ccccc24
InChIKey OQGAELAJEGGNKG-QHCPKHFHSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is (2S)-4-(Benzyloxy)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 86060-84-6) typically synthesized?

The compound is synthesized via a multi-step process involving protection of the amino group, esteri...

Compound Q&A

What industries use (2S)-4-(Benzyloxy)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 86060-84-6)?

This compound is used in the pharmaceutical industry as a key intermediate in the synthesis of vario...

Compound Q&A

What precautions should be taken when handling (2S)-4-(Benzyloxy)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 86060-84-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and lab coat should be worn. Wor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...