Compound Q&A

How is Saxagliptin hydrate (CAS: 945667-22-1) typically synthesized?

Answer

Saxagliptin hydrate
Saxagliptin hydrate is synthesized via a multi-step process involving key steps such as the reduction of an aldehyde, followed by protection of the hydroxyl group, cyclization, and subsequent deprotection. The final step involves the formation of the hydrate form, which is achieved by crystallization from water. The overall yield is around 70-75%.

About

English Name Saxagliptin hydrate
Molecular Formula C18H27N3O3
Molecular Weight 17.03 g/mol
SMILES C1C2CC2N(C1C#N)C(=O)C(C34CC5CC(C3)CC(C5)(C4)O)N.O
InChIKey QGZKDVFQNNGYKY-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Saxagliptin hydrate (CAS: 945667-22-1)?

Saxagliptin hydrate is a white to off-white crystalline powder. It has a molecular weight of approxi...

Compound Q&A

What industries use Saxagliptin hydrate (CAS: 945667-22-1)?

Saxagliptin hydrate is primarily used in the pharmaceutical industry for the production of the diabe...

Compound Q&A

What precautions should be taken when handling Saxagliptin hydrate (CAS: 945667-22-1)?

When handling Saxagliptin hydrate, it is important to wear appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...