Compound Q&A

What industries use 1-Allyl-3-methyl-1H-imidazol-3-ium chloride (CAS: 65039-10-3)?

Answer

1-Allyl-3-methyl-1H-imidazol-3-ium chloride
1-Allyl-3-methyl-1H-imidazol-3-ium chloride finds applications in the pharmaceutical industry for synthesizing certain drugs, and in the semiconductor industry for use as a dopant. It is also utilized in the sensor industry for developing gas detection devices due to its sensitivity to specific gases.

About

CAS No 65039-10-3
English Name 1-Allyl-3-methyl-1H-imidazol-3-ium chloride
Molecular Formula C7H11ClN2
Molecular Weight 158.63 g/mol
SMILES C[N+]1=CN(C=C1)CC=C.[Cl-]
InChIKey QVRCRKLLQYOIKY-UHFFFAOYSA-M
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Allyl-3-methyl-1H-imidazol-3-ium chloride (CAS: 65039-10-3)?

1-Allyl-3-methyl-1H-imidazol-3-ium chloride is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 1-Allyl-3-methyl-1H-imidazol-3-ium chloride (CAS: 65039-10-3) typically synthesized?

1-Allyl-3-methyl-1H-imidazol-3-ium chloride is commonly synthesized by reacting 1-methylimidazole wi...

Compound Q&A

What precautions should be taken when handling 1-Allyl-3-methyl-1H-imidazol-3-ium chloride (CAS: 65039-10-3)?

When handling 1-Allyl-3-methyl-1H-imidazol-3-ium chloride, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...