Compound Q&A

What are the physical and chemical properties of 1-Allyl-3-methyl-1H-imidazol-3-ium chloride (CAS: 65039-10-3)?

Answer

1-Allyl-3-methyl-1H-imidazol-3-ium chloride
1-Allyl-3-methyl-1H-imidazol-3-ium chloride is a crystalline solid with a molecular weight of approximately 163.24 g/mol. It has a low solubility in water and high solubility in organic solvents. It exhibits basic behavior and is reactive towards acidic compounds. This compound is stable under normal laboratory conditions but should be stored in a dry, cool place to prevent degradation.

About

CAS No 65039-10-3
English Name 1-Allyl-3-methyl-1H-imidazol-3-ium chloride
Molecular Formula C7H11ClN2
Molecular Weight 158.63 g/mol
SMILES C[N+]1=CN(C=C1)CC=C.[Cl-]
InChIKey QVRCRKLLQYOIKY-UHFFFAOYSA-M
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 1-Allyl-3-methyl-1H-imidazol-3-ium chloride (CAS: 65039-10-3) typically synthesized?

1-Allyl-3-methyl-1H-imidazol-3-ium chloride is commonly synthesized by reacting 1-methylimidazole wi...

Compound Q&A

What industries use 1-Allyl-3-methyl-1H-imidazol-3-ium chloride (CAS: 65039-10-3)?

1-Allyl-3-methyl-1H-imidazol-3-ium chloride finds applications in the pharmaceutical industry for sy...

Compound Q&A

What precautions should be taken when handling 1-Allyl-3-methyl-1H-imidazol-3-ium chloride (CAS: 65039-10-3)?

When handling 1-Allyl-3-methyl-1H-imidazol-3-ium chloride, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...