Compound Q&A

How is Spinosad (CAS: 168316-95-8) typically synthesized?

Answer

Spinosad
Spinosad (CAS: 168316-95-8) is synthesized through a fermentation process involving Saccharopolyspora species. The fermentation broth is extracted, purified, and then formulated into various products. The fermentation process requires specific conditions such as pH and temperature, and the use of appropriate catalysts to enhance selectivity and yield.

About

English Name Spinosad
Molecular Formula C41H65NO10
Molecular Weight 731.96 g/mol
EINECS 605-513-9
SMILES CC[C@H]1CCC[C@@H]([C@@H](C)C(=O)C2=C[C@@H]3[C@H](C=C[C@@H]4C[C@H](C[C@H]43)O[C@H]5[C@@H]([C@@H]([C@H]([C@H](C)O5)OC)OC)OC)C2CC(=O)O1)O[C@H]6CC[C@@H]([C@@H](C)O6)N(C)C
InChIKey SRJQTHAZUNRMPR-MGGCLMNKSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Spinosad (CAS: 168316-95-8)?

Spinosad (CAS: 168316-95-8) is a naturally occurring insecticide with a crystalline form. It has a m...

Compound Q&A

What industries use Spinosad (CAS: 168316-95-8)?

Spinosad (CAS: 168316-95-8) is widely used in the agricultural and pharmaceutical industries. It is ...

Compound Q&A

What precautions should be taken when handling Spinosad (CAS: 168316-95-8)?

When handling Spinosad (CAS: 168316-95-8), appropriate personal protective equipment (PPE) should be...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...