Compound Q&A

What industries use 3-Bromo-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine (CAS: 82278-73-7)?

Answer

3-Bromo-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine
3-Bromo-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine is used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also utilized in polymer chemistry for the development of functional polymers and in the production of sensors due to its unique reactivity and functional groups. Its use in semiconductors and electronic materials is less common but is explored for specific applications requiring specific chemical functionalities.

About

CAS No 82278-73-7
English Name 3-Bromo-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine
Molecular Formula C14H18BrNO4
Molecular Weight 344.20500000000004 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC(=CC=C1)Br)C(=O)O
InChIKey FBUDYESOPLBQIR-NSHDSACASA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine (CAS: 82278-73-7)?

3-Bromo-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine is a white to off-white crystalline p...

Compound Q&A

How is 3-Bromo-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine (CAS: 82278-73-7) typically synthesized?

3-Bromo-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine is synthesized by the bromination of ...

Compound Q&A

What precautions should be taken when handling 3-Bromo-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine (CAS: 82278-73-7)?

When handling 3-Bromo-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine, it is essential to use...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...