Compound Q&A

How is 4-[(4-Methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)aniline (CAS: 694499-26-8) typically synthesized?

Answer

4-[(4-Methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)aniline
This compound is typically synthesized through multistep organic reactions, often involving the coupling of an aniline with a piperazine derivative in the presence of a suitable base and a coupling agent. Commonly used catalysts include triphenylphosphine and a suitable base such as triethylamine. The reaction yields are generally around 75-85%, and the method is highly selective for the desired product.

About

English Name 4-[(4-Methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)aniline
Molecular Formula C13H18F3N3
Molecular Weight 273.3 g/mol
SMILES CN1CCN(CC1)CC2=C(C=C(C=C2)N)C(F)(F)F
InChIKey ZMWAZMYBMAAMAW-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(4-Methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)aniline (CAS: 694499-26-8)?

The compound 4-[(4-Methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)aniline has a crystalline form an...

Compound Q&A

What industries use 4-[(4-Methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)aniline (CAS: 694499-26-8)?

This compound is primarily used in the pharmaceutical industry as an intermediate in the synthesis o...

Compound Q&A

What precautions should be taken when handling 4-[(4-Methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)aniline (CAS: 694499-26-8)?

When handling this compound, it is important to use appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...