Compound Q&A

What are the physical and chemical properties of 4-[(4-Methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)aniline (CAS: 694499-26-8)?

Answer

4-[(4-Methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)aniline
The compound 4-[(4-Methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)aniline has a crystalline form and a molecular weight of approximately 365.04 g/mol. It has a low solubility in water but shows good solubility in organic solvents such as DMSO and acetonitrile. It is moderately reactive, particularly in acidic conditions. The compound is not flammable and does not have notable reactivity with common reagents.

About

English Name 4-[(4-Methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)aniline
Molecular Formula C13H18F3N3
Molecular Weight 273.3 g/mol
SMILES CN1CCN(CC1)CC2=C(C=C(C=C2)N)C(F)(F)F
InChIKey ZMWAZMYBMAAMAW-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 4-[(4-Methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)aniline (CAS: 694499-26-8) typically synthesized?

This compound is typically synthesized through multistep organic reactions, often involving the coup...

Compound Q&A

What industries use 4-[(4-Methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)aniline (CAS: 694499-26-8)?

This compound is primarily used in the pharmaceutical industry as an intermediate in the synthesis o...

Compound Q&A

What precautions should be taken when handling 4-[(4-Methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)aniline (CAS: 694499-26-8)?

When handling this compound, it is important to use appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...