Compound Q&A

What industries use Hydroxypinacolone Retinoate (CAS: 893412-73-2)?

Answer

Hydroxypinacolone Retinoate
Hydroxypinacolone Retinoate (CAS: 893412-73-2) is primarily used in the pharmaceutical industry for its potential skin benefits. It is also utilized in the cosmetic industry for its antioxidant and anti-aging properties. Additionally, it has applications in the polymer industry for enhancing material properties and in the food industry as a preservative.

About

English Name Hydroxypinacolone Retinoate
Molecular Formula C26H38O3
Molecular Weight 398.59 g/mol
SMILES CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC(=O)OCC(=O)C(C)(C)C)C)C
InChIKey XLPLFRLIWKRQFT-XUJYDZMUSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hydroxypinacolone Retinoate (CAS: 893412-73-2)?

Hydroxypinacolone Retinoate (CAS: 893412-73-2) has a crystalline form with a molecular weight of app...

Compound Q&A

How is Hydroxypinacolone Retinoate (CAS: 893412-73-2) typically synthesized?

Hydroxypinacolone Retinoate (CAS: 893412-73-2) is typically synthesized through the esterification o...

Compound Q&A

What precautions should be taken when handling Hydroxypinacolone Retinoate (CAS: 893412-73-2)?

When handling Hydroxypinacolone Retinoate (CAS: 893412-73-2), it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...