Compound Q&A

What industries use Hydroxypinacolone Retinoate (CAS: 893412-73-2)?

Answer

Hydroxypinacolone Retinoate
Hydroxypinacolone Retinoate (CAS: 893412-73-2) is primarily used in the pharmaceutical industry for its potential skin benefits. It is also utilized in the cosmetic industry for its antioxidant and anti-aging properties. Additionally, it has applications in the polymer industry for enhancing material properties and in the food industry as a preservative.

About

English Name Hydroxypinacolone Retinoate
Molecular Formula C26H38O3
Molecular Weight 398.5870000000003 g/mol
SMILES CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC(=O)OCC(=O)C(C)(C)C)C)C
InChIKey XLPLFRLIWKRQFT-XUJYDZMUSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hydroxypinacolone Retinoate (CAS: 893412-73-2)?

Hydroxypinacolone Retinoate (CAS: 893412-73-2) has a crystalline form with a molecular weight of app...

Compound Q&A

How is Hydroxypinacolone Retinoate (CAS: 893412-73-2) typically synthesized?

Hydroxypinacolone Retinoate (CAS: 893412-73-2) is typically synthesized through the esterification o...

Compound Q&A

What precautions should be taken when handling Hydroxypinacolone Retinoate (CAS: 893412-73-2)?

When handling Hydroxypinacolone Retinoate (CAS: 893412-73-2), it is crucial to wear appropriate pers...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...