Compound Q&A

What are the physical and chemical properties of Hydroxypinacolone Retinoate (CAS: 893412-73-2)?

Answer

Hydroxypinacolone Retinoate
Hydroxypinacolone Retinoate (CAS: 893412-73-2) has a crystalline form with a molecular weight of approximately 302.37 g/mol. Its solubility is limited in water but increases in organic solvents like ethanol. The compound is relatively stable, showing reduced reactivity towards common acids and bases, but it can undergo hydrolysis under basic conditions. It is insoluble in water but soluble in polar organic solvents.

About

English Name Hydroxypinacolone Retinoate
Molecular Formula C26H38O3
Molecular Weight 398.5870000000003 g/mol
SMILES CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC(=O)OCC(=O)C(C)(C)C)C)C
InChIKey XLPLFRLIWKRQFT-XUJYDZMUSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Hydroxypinacolone Retinoate (CAS: 893412-73-2) typically synthesized?

Hydroxypinacolone Retinoate (CAS: 893412-73-2) is typically synthesized through the esterification o...

Compound Q&A

What industries use Hydroxypinacolone Retinoate (CAS: 893412-73-2)?

Hydroxypinacolone Retinoate (CAS: 893412-73-2) is primarily used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling Hydroxypinacolone Retinoate (CAS: 893412-73-2)?

When handling Hydroxypinacolone Retinoate (CAS: 893412-73-2), it is crucial to wear appropriate pers...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...