Compound Q&A

What precautions should be taken when handling Xanthoxylin (CAS: 90-24-4)?

Answer

Xanthoxylin
When handling Xanthoxylin (CAS: 90-24-4), it is essential to wear appropriate personal protective equipment (PPE) such as gloves and safety glasses. Work should be conducted in a well-ventilated area or fume hood to avoid inhalation. Spills should be cleaned up immediately, and the Material Safety Data Sheet (MSDS) should be consulted for detailed spill procedures and emergency response guidelines.

About

CAS No 90-24-4
English Name Xanthoxylin
Molecular Formula C10H12O4
Molecular Weight 196.2 g/mol
SMILES CC(=O)C1=C(C=C(C=C1OC)OC)O
InChIKey FBUBVLUPUDBFME-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Xanthoxylin (CAS: 90-24-4)?

Xanthoxylin (CAS: 90-24-4) is a crystalline compound with a molecular weight of approximately 282.29...

Compound Q&A

How is Xanthoxylin (CAS: 90-24-4) typically synthesized?

Xanthoxylin (CAS: 90-24-4) can be synthesized through a multi-step reaction involving the condensati...

Compound Q&A

What industries use Xanthoxylin (CAS: 90-24-4)?

Xanthoxylin (CAS: 90-24-4) is primarily used in the pharmaceutical industry for its potential in dev...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...