Compound Q&A

What are the physical and chemical properties of Xanthoxylin (CAS: 90-24-4)?

Answer

Xanthoxylin
Xanthoxylin (CAS: 90-24-4) is a crystalline compound with a molecular weight of approximately 282.29 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. Xanthoxylin is relatively stable under normal conditions but can react with strong acids. It is used in various chemical reactions due to its reactive nature.

About

CAS No 90-24-4
English Name Xanthoxylin
Molecular Formula C10H12O4
Molecular Weight 196.2 g/mol
SMILES CC(=O)C1=C(C=C(C=C1OC)OC)O
InChIKey FBUBVLUPUDBFME-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Xanthoxylin (CAS: 90-24-4) typically synthesized?

Xanthoxylin (CAS: 90-24-4) can be synthesized through a multi-step reaction involving the condensati...

Compound Q&A

What industries use Xanthoxylin (CAS: 90-24-4)?

Xanthoxylin (CAS: 90-24-4) is primarily used in the pharmaceutical industry for its potential in dev...

Compound Q&A

What precautions should be taken when handling Xanthoxylin (CAS: 90-24-4)?

When handling Xanthoxylin (CAS: 90-24-4), it is essential to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...