Compound Q&A

How is 2,5-Dichlorobenzoyl chloride (CAS: 2905-61-5) typically synthesized?

Answer

2,5-Dichlorobenzoyl chloride
2,5-Dichlorobenzoyl chloride is typically synthesized by the reaction of 2,5-dichlorobenzoic acid with thionyl chloride. Commonly, thionyl chloride is added to a solution of 2,5-dichlorobenzoic acid and the mixture is heated under reflux to enhance the reaction. The yield is generally high, and the process is conducted under mild conditions to avoid overoxidation of the aromatic ring.

About

CAS No 2905-61-5
English Name 2,5-Dichlorobenzoyl chloride
Molecular Formula C7H3Cl3O
Molecular Weight 209.46 g/mol
SMILES C1=CC(=C(C=C1Cl)C(=O)Cl)Cl
InChIKey RSINFFVFOTUDEC-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-Dichlorobenzoyl chloride (CAS: 2905-61-5)?

2,5-Dichlorobenzoyl chloride is a yellow to amber-colored liquid at room temperature. It has a molec...

Compound Q&A

What industries use 2,5-Dichlorobenzoyl chloride (CAS: 2905-61-5)?

2,5-Dichlorobenzoyl chloride finds applications in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling 2,5-Dichlorobenzoyl chloride (CAS: 2905-61-5)?

When handling 2,5-Dichlorobenzoyl chloride, it is essential to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...