Compound Q&A

What are the physical and chemical properties of (17beta)-3-Hydroxyestra-1,3,5(10)-trien-17-yl heptanoate (CAS: 4956-37-0)?

Answer

(17beta)-3-Hydroxyestra-1,3,5(10)-trien-17-yl heptanoate
(17beta)-3-Hydroxyestra-1,3,5(10)-trien-17-yl heptanoate is a crystalline compound with a molecular weight of approximately 324.41 g/mol. It is sparingly soluble in water but soluble in organic solvents such as ethanol and acetone. Chemically, it exhibits moderate reactivity towards basic conditions, making it sensitive to hydrolysis. Its stability is enhanced by storage in a dry and cool environment.

About

CAS No 4956-37-0
English Name (17beta)-3-Hydroxyestra-1,3,5(10)-trien-17-yl heptanoate
Molecular Formula C25H36O3
Molecular Weight 384.56 g/mol
SMILES CCCCCCC(=O)OC1CCC2C1(CCC3C2CCC4=C3C=CC(=C4)O)C
InChIKey RFWTZQAOOLFXAY-BZDYCCQFSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is (17beta)-3-Hydroxyestra-1,3,5(10)-trien-17-yl heptanoate (CAS: 4956-37-0) typically synthesized?

(17beta)-3-Hydroxyestra-1,3,5(10)-trien-17-yl heptanoate is typically synthesized via a multi-step p...

Compound Q&A

What industries use (17beta)-3-Hydroxyestra-1,3,5(10)-trien-17-yl heptanoate (CAS: 4956-37-0)?

(17beta)-3-Hydroxyestra-1,3,5(10)-trien-17-yl heptanoate is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling (17beta)-3-Hydroxyestra-1,3,5(10)-trien-17-yl heptanoate (CAS: 4956-37-0)?

When handling (17beta)-3-Hydroxyestra-1,3,5(10)-trien-17-yl heptanoate, it is important to use perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...