Compound Q&A

What precautions should be taken when handling dicarbonylacetylacetonato rhodium(I) (CAS: 14874-82-9)?

Answer

Dicarbonylacetylacetonato rhodium(I)
Safety precautions when handling dicarbonylacetylacetylacetonato rhodium(I) (CAS: 14874-82-9) include wearing appropriate personal protective equipment (PPE), such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or fume hood to minimize inhalation risk. Spills should be cleaned up using appropriate methods, and the material safety data sheet (MSDS) should be consulted for detailed safety information.

About

CAS No 14874-82-9
English Name Dicarbonylacetylacetonato rhodium(I)
Molecular Formula C7H8O4Rh
Molecular Weight 259.04 g/mol
EINECS 238-947-9
SMILES CC1=[O+][Rh-4](C#[O+])(C#[O+])[O+]=C(C)C1
InChIKey BZCAWKOPWNIDOC-FGSKAQBVSA-M
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of dicarbonylacetylacetonato rhodium(I) (CAS: 14874-82-9)?

Dicarbonylacetylacetonato rhodium(I) (CAS: 14874-82-9) is a yellow solid with a crystalline form. It...

Compound Q&A

How is dicarbonylacetylacetonato rhodium(I) (CAS: 14874-82-9) typically synthesized?

Dicarbonylacetylacetonato rhodium(I) (CAS: 14874-82-9) is typically synthesized by reacting rhodium(...

Compound Q&A

What industries use dicarbonylacetylacetonato rhodium(I) (CAS: 14874-82-9)?

Dicarbonylacetylacetonato rhodium(I) (CAS: 14874-82-9) is utilized in various industries, particular...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...