Compound Q&A

What industries use dicarbonylacetylacetonato rhodium(I) (CAS: 14874-82-9)?

Answer

Dicarbonylacetylacetonato rhodium(I)
Dicarbonylacetylacetonato rhodium(I) (CAS: 14874-82-9) is utilized in various industries, particularly in catalysis for organic synthesis, where it plays a crucial role in catalyzing hydrogenation reactions. It is also used in the production of pharmaceuticals, polymers, and as a component in sensors and semiconductors.

About

CAS No 14874-82-9
English Name Dicarbonylacetylacetonato rhodium(I)
Molecular Formula C7H8O4Rh
Molecular Weight 259.04 g/mol
EINECS 238-947-9
SMILES CC1=[O+][Rh-4](C#[O+])(C#[O+])[O+]=C(C)C1
InChIKey BZCAWKOPWNIDOC-FGSKAQBVSA-M
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of dicarbonylacetylacetonato rhodium(I) (CAS: 14874-82-9)?

Dicarbonylacetylacetonato rhodium(I) (CAS: 14874-82-9) is a yellow solid with a crystalline form. It...

Compound Q&A

How is dicarbonylacetylacetonato rhodium(I) (CAS: 14874-82-9) typically synthesized?

Dicarbonylacetylacetonato rhodium(I) (CAS: 14874-82-9) is typically synthesized by reacting rhodium(...

Compound Q&A

What precautions should be taken when handling dicarbonylacetylacetonato rhodium(I) (CAS: 14874-82-9)?

Safety precautions when handling dicarbonylacetylacetylacetonato rhodium(I) (CAS: 14874-82-9) includ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...