Compound Q&A

What industries use (2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid (CAS: 1676-73-9)?

Answer

(2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid
(2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid finds applications in pharmaceuticals, where it may be used as an intermediate or active pharmaceutical ingredient (API). It is also relevant in the development of certain sensors and semiconductors due to its chemical functionality. Its use in polymer chemistry is also plausible, although specific applications may vary.

About

CAS No 1676-73-9
English Name (2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid
Molecular Formula C12H15NO4
Molecular Weight 237.26 g/mol
SMILES C1=CC=C(C=C1)COC(=O)CCC(C(=O)O)N
InChIKey BGGHCRNCRWQABU-JTQLQIEISA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid (CAS: 1676-73-9)?

(2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid is a white crystalline solid with a molecular weight ...

Compound Q&A

How is (2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid (CAS: 1676-73-9) typically synthesized?

(2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid can be synthesized through a multistep process involv...

Compound Q&A

What precautions should be taken when handling (2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid (CAS: 1676-73-9)?

When handling (2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid, it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...