Compound Q&A

How is (2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid (CAS: 1676-73-9) typically synthesized?

Answer

(2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid
(2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid can be synthesized through a multistep process involving the reaction of benzyloxyacetic acid with amino compounds. Commonly, this involves protecting the amino group with a suitable protecting group, followed by deprotection to yield the desired compound. This synthesis typically requires the use of specific catalysts and solvents to achieve high yield and selectivity.

About

CAS No 1676-73-9
English Name (2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid
Molecular Formula C12H15NO4
Molecular Weight 237.26 g/mol
SMILES C1=CC=C(C=C1)COC(=O)CCC(C(=O)O)N
InChIKey BGGHCRNCRWQABU-JTQLQIEISA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid (CAS: 1676-73-9)?

(2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid is a white crystalline solid with a molecular weight ...

Compound Q&A

What industries use (2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid (CAS: 1676-73-9)?

(2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid finds applications in pharmaceuticals, where it may b...

Compound Q&A

What precautions should be taken when handling (2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid (CAS: 1676-73-9)?

When handling (2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid, it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...